cas: 672309-94-3 — see every product listed under this CAS number, including other names
(R)-Benzyl (1,4-dihydroxybutan-2-yl)carbamate 97% (CAS 672309-94-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A833416-1g |
| cas | 672309-94-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 1850.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A833416 |
Benzyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate (CAS 672309-94-3) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: benzyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate. InChIKey: UZEHYMIWBJBOPW-LLVKDONJSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | benzyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate |
| InChIKey | UZEHYMIWBJBOPW-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCO)CO |
Computed by PubChem (NCBI)