CAS 876294-66-5 appears in our catalog under these names: 3-[3-(Ethoxycarbonyl)-2,5-dimethyl-1h-pyrrol-1-yl]propanoic acid, 95%, 3-(3-(Ethoxycarbonyl)-2,5-dimethyl-1H-pyrrol-1-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-(3-ethoxycarbonyl-2,5-dimethylpyrrol-1-yl)propanoic acid (CAS 876294-66-5) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: 3-(3-ethoxycarbonyl-2,5-dimethylpyrrol-1-yl)propanoic acid. InChIKey: ZMEURRCNVLHWSR-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 3-(3-ethoxycarbonyl-2,5-dimethylpyrrol-1-yl)propanoic acid |
| InChIKey | ZMEURRCNVLHWSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1)C)CCC(=O)O)C |
Computed by PubChem (NCBI)