CAS 79723-02-7 appears in our catalog under these names: Tetramethylammonium hydrogen phthalate, 95%, Tetramethylammonium hydrogen phthalate, 99+% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g.
2-carboxybenzoate;tetramethylazanium (CAS 79723-02-7) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: 2-carboxybenzoate;tetramethylazanium. InChIKey: KQTFRASJMFIJPC-UHFFFAOYSA-M.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 2-carboxybenzoate;tetramethylazanium |
| InChIKey | KQTFRASJMFIJPC-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.C1=CC=C(C(=C1)C(=O)O)C(=O)[O-] |
Computed by PubChem (NCBI)