Products 1435933-04-2
CAS 1435933-04-2 is the registry number for tert-Butyl 4-hydroxy-2-methoxyphenylcarbamate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-(4-hydroxy-2-methoxyphenyl)carbamate (CAS 1435933-04-2) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: tert-butyl N-(4-hydroxy-2-methoxyphenyl)carbamate. InChIKey: UUWWYFQJCAFFSU-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | tert-butyl N-(4-hydroxy-2-methoxyphenyl)carbamate |
| InChIKey | UUWWYFQJCAFFSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)O)OC |
Computed by PubChem (NCBI)