cas: 172793-31-6 — see every product listed under this CAS number, including other names
(R)-Di-tert-butyl 2-aminopentanedioate hydrochloride, 98%, 98% (CAS 172793-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118CF7-250mg |
| cas | 172793-31-6 |
| size | 250mg |
| availability | 991.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 50g | 275.60 Pln | |
| Chemat | 250g | 990.80 Pln | |
| Chemat | 500g | 1852.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl (2R)-2-aminopentanedioate;hydrochloride (CAS 172793-31-6) is a chemical compound with the molecular formula C13H26ClNO4 and a molecular weight of 295.80 g/mol. IUPAC name: ditert-butyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: LFEYMWCCUAOUKZ-SBSPUUFOSA-N.
| Molecular formula | C13H26ClNO4 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | ditert-butyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | LFEYMWCCUAOUKZ-SBSPUUFOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)