cas: 172793-31-6 — see every product listed under this CAS number, including other names
H-D-Glu(OtBu)-OtBu·HCl 97% (CAS 172793-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133931-250mg |
| cas | 172793-31-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 921.06 Pln | |
| Ambeed | 500g | 3485.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A133931 |
Ditert-butyl (2R)-2-aminopentanedioate;hydrochloride (CAS 172793-31-6) is a chemical compound with the molecular formula C13H26ClNO4 and a molecular weight of 295.80 g/mol. IUPAC name: ditert-butyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: LFEYMWCCUAOUKZ-SBSPUUFOSA-N.
| Molecular formula | C13H26ClNO4 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | ditert-butyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | LFEYMWCCUAOUKZ-SBSPUUFOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)