cas: 13071-11-9 — see every product listed under this CAS number, including other names
(R)-Propranolol (hydrochloride), 99.36% (CAS 13071-11-9) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-A0295-10mM/1mL |
| cas | 13071-11-9 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 407.93 Pln | |
| MedChemExpress | 100 mg | 551.89 Pln | |
| MedChemExpress | 50 mg | 384.71 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.36% |
(2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride (CAS 13071-11-9) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 295.80 g/mol. IUPAC name: (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: ZMRUPTIKESYGQW-PFEQFJNWSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | ZMRUPTIKESYGQW-PFEQFJNWSA-N |
| SMILES | CC(C)NC[C@H](COC1=CC=CC2=CC=CC=C21)O.Cl |
Computed by PubChem (NCBI)