Products 3087-01-2

CAS 3087-01-2 is the registry number for Atropine Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylacetate;hydrochloride (CAS 3087-01-2) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 295.80 g/mol. IUPAC name: (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylacetate;hydrochloride. InChIKey: IFNUPGBWWRYLQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22ClNO2
Molecular weight295.80 g/mol
IUPAC name(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylacetate;hydrochloride
InChIKeyIFNUPGBWWRYLQZ-UHFFFAOYSA-N
SMILESCN1C2CCC1CC(C2)OC(=O)CC3=CC=CC=C3.Cl

Computed by PubChem (NCBI)