CAS 318-98-9 appears in our catalog under these names: Propranolol hydrochloride, 98%, Propranolol HCl, Propranolol, d,l-Propranolol.HCl, d,l-Propranolol.HCl, 1mg/ml in Methanol (as free base). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, Lipomed, TRC. Available pack sizes: 100g, 25g, 500g, 5g, on request, 10mg, 25mg, 50mg.
1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride (CAS 318-98-9) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 295.80 g/mol. IUPAC name: 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: ZMRUPTIKESYGQW-UHFFFAOYSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
Computed by PubChem (NCBI)