Products 1346617-25-1
CAS 1346617-25-1 appears in our catalog under these names: (R)-Propranolol-d7 HCl, (R)-Propranolol-d7 Hydrochloride, >95% (HPLC), (R)-Propranolol-d7. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
(2R)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol;hydrochloride (CAS 1346617-25-1) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 302.85 g/mol. IUPAC name: (2R)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol;hydrochloride. InChIKey: ZMRUPTIKESYGQW-DECJMFKTSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 302.85 g/mol |
| IUPAC name | (2R)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
| InChIKey | ZMRUPTIKESYGQW-DECJMFKTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC[C@H](COC1=CC=CC2=CC=CC=C21)O.Cl |
Computed by PubChem (NCBI)