cas: 146553-06-2 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1-(methoxy(methyl)amino)-1-oxopropan-2-yl)carbamate, 98%, 98% (CAS 146553-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112E64-100mg |
| cas | 146553-06-2 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 328.40 Pln | |
| Chemat | 25g | 626.00 Pln | |
| Chemat | 50g | 1077.20 Pln | |
| Chemat | 100g | 1950.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate (CAS 146553-06-2) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate. InChIKey: PWQIGBOSLQHOBT-SSDOTTSWSA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | PWQIGBOSLQHOBT-SSDOTTSWSA-N |
| SMILES | C[C@H](C(=O)N(C)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)