CAS 110755-32-3 appears in our catalog under these names: Boc-3-NMe2-D-Ala-OH 95%, N-Boc-3-dimethylamino-D-alanine, 95%, 95%, Boc-beta-n,n-dimethylamino-d-ala, 95%. Offered by: Ambeed, Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 110755-32-3) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: (2R)-3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VCDQZVYJKDSORW-SSDOTTSWSA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (2R)-3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VCDQZVYJKDSORW-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN(C)C)C(=O)O |
Computed by PubChem (NCBI)