Products 1185121-07-6

CAS 1185121-07-6 is the registry number for N-Methyl-1-(1-methyl-2-piperidinyl)methanamine oxalate (1:2), 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

N-methyl-1-(1-methylpiperidin-2-yl)methanamine;oxalic acid (CAS 1185121-07-6) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: N-methyl-1-(1-methylpiperidin-2-yl)methanamine;oxalic acid. InChIKey: RNJMXUCSHCOLQB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20N2O4
Molecular weight232.28 g/mol
IUPAC nameN-methyl-1-(1-methylpiperidin-2-yl)methanamine;oxalic acid
InChIKeyRNJMXUCSHCOLQB-UHFFFAOYSA-N
SMILESCNCC1CCCCN1C.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)