CAS 2007915-76-4 appears in our catalog under these names: (R)-2-Amino-3-((tert-butoxycarbonyl)amino)-3-methylbutanoic acid, 95%, H-3-NHBoc-D-Val-OH 95%, (R)-2-Amino-3-((tert-butoxycarbonyl)amino)-3-methylbutanoic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2007915-76-4) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: (2R)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: SJHUKHWDMTTYMY-LURJTMIESA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (2R)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | SJHUKHWDMTTYMY-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)