cas: 77119-85-8 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1-oxo-3-phenylpropan-2-yl)carbamate, 95%, 95% (CAS 77119-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C63-100mg |
| cas | 77119-85-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1178.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2R)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 77119-85-8) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: tert-butyl N-[(2R)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: ZJTYRNPLVNMVPQ-GFCCVEGCSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | ZJTYRNPLVNMVPQ-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)C=O |
Computed by PubChem (NCBI)