cas: 1217858-20-2 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (pyrrolidin-3-ylmethyl)carbamate hydrochloride 95% (CAS 1217858-20-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231677-100mg |
| cas | 1217858-20-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2428.50 Pln | |
| Ambeed | 25g | 5098.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A231677 |
Tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride (CAS 1217858-20-2) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride. InChIKey: WEUDEPABMRKFFT-DDWIOCJRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride |
| InChIKey | WEUDEPABMRKFFT-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCNC1.Cl |
Computed by PubChem (NCBI)