cas: 132482-05-4 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate 95+% (CAS 132482-05-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A251483-100mg |
| cas | 132482-05-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 2167.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A251483 |
Tert-butyl (2R)-2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate (CAS 132482-05-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (2R)-2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate. InChIKey: LZYBAKVGAMQFLJ-SECBINFHSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (2R)-2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
| InChIKey | LZYBAKVGAMQFLJ-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CC(=O)OC |
Computed by PubChem (NCBI)