CAS 813433-68-0 appears in our catalog under these names: tert-Butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate, 95%, N-Boc-pyrrolidin-2-yl-acetic acid methyl ester, 98+%, N-Boc-pyrrolidin-2-yl-acetic acid methyl ester. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 50mg, 500mg, 2.5g.
Tert-butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate (CAS 813433-68-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate. InChIKey: LZYBAKVGAMQFLJ-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
| InChIKey | LZYBAKVGAMQFLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CC(=O)OC |
Computed by PubChem (NCBI)