cas: 1363378-13-5 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-(bromomethyl)azetidine-1-carboxylate, 95%, 95% (CAS 1363378-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122O2-100mg |
| cas | 1363378-13-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 500mg | 803.60 Pln | |
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 5g | 3774.80 Pln | |
| Chemat | 10g | 6558.80 Pln | |
| Chemat | 25g | 13058.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R)-2-(bromomethyl)azetidine-1-carboxylate (CAS 1363378-13-5) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl (2R)-2-(bromomethyl)azetidine-1-carboxylate. InChIKey: YDUBHKXBYBMWRH-SSDOTTSWSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl (2R)-2-(bromomethyl)azetidine-1-carboxylate |
| InChIKey | YDUBHKXBYBMWRH-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]1CBr |
Computed by PubChem (NCBI)