(R)-tert-Butyl 3-(trifluoromethyl)piperazine-1-carboxylate, 97%
cas: 1240587-88-5 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 3-(trifluoromethyl)piperazine-1-carboxylate, 97% (CAS 1240587-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg, 50mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A212166-100mg |
| cas | 1240587-88-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 854.31 Pln | |
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 2595.38 Pln | |
| Ambeed | 5g | 7089.88 Pln | |
| Chemat | 25mg | 208.40 Pln | |
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 914.00 Pln | |
| Chemat | 500mg | 1547.60 Pln | |
| Chemat | 1g | 1854.80 Pln | |
| Chemat | 5g | 5277.20 Pln | |
| BLDpharm | 50mg | 503.18 Pln | |
| BLDpharm | 100mg | 914.15 Pln | |
| BLDpharm | 250mg | 1363.99 Pln | |
| BLDpharm | 1g | 2791.26 Pln | |
| BLDpharm | 5g | 7639.56 Pln | |
| Fluorochem | 25mg | 336.36 Pln | |
| Fluorochem | 50mg | 476.93 Pln | |
| Fluorochem | 100mg | 841.39 Pln | |
| Fluorochem | 250mg | 1309.97 Pln | |
| Fluorochem | 1g | 2674.08 Pln | |
| Fluorochem | 5g | 7115.22 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate (CAS 1240587-88-5) is a chemical compound with the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. IUPAC name: tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate. InChIKey: WCGKHZHOGLVVPU-SSDOTTSWSA-N.
| Molecular formula | C10H17F3N2O2 |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate |
| InChIKey | WCGKHZHOGLVVPU-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
(3R)-3-(Trifluoromethyl)-1-piperazinecarboxylic acid 1,1-Dimethylethyl Ester, (R)-1-Boc-3-(trifluoromethyl)piperazine, tert-butyl (R)-3-(trifluoromethyl)piperazine-1-carboxylate, (R)-3-(trifluoromethyl)piperazine-1-carboxylic acid tert-butyl ester, (R)-3-Trifluoromethyl-piperazine-1-carboxylic acid t-butyl ester, tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate - [B81901]