CAS 1240587-88-5 appears in our catalog under these names: (3R)-3-(Trifluoromethyl)-1-piperazinecarboxylic acid 1,1-Dimethylethyl Ester, (R)–tert–Butyl 3–(trifluoromethyl)piperazine–1–carboxylate, (R)-tert-Butyl 3-(trifluoromethyl)piperazine-1-carboxylate, 97%, 97%, (R)-tert-Butyl 3-(trifluoromethyl)piperazine-1-carboxylate, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 25mg, 50mg, 100mg, 500mg, 1g, 5g.
Tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate (CAS 1240587-88-5) is a chemical compound with the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. IUPAC name: tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate. InChIKey: WCGKHZHOGLVVPU-SSDOTTSWSA-N.
| Molecular formula | C10H17F3N2O2 |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | tert-butyl (3R)-3-(trifluoromethyl)piperazine-1-carboxylate |
| InChIKey | WCGKHZHOGLVVPU-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)C(F)(F)F |
Computed by PubChem (NCBI)