cas: 1217469-14-1 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 3-isobutylpiperazine-1-carboxylate hydrochloride 95% (CAS 1217469-14-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A299322-100mg |
| cas | 1217469-14-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 882.12 Pln | |
| Ambeed | 10g | 1621.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A299322 |
Tert-butyl (3R)-3-(2-methylpropyl)piperazine-1-carboxylate;hydrochloride (CAS 1217469-14-1) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl (3R)-3-(2-methylpropyl)piperazine-1-carboxylate;hydrochloride. InChIKey: BHOIFVAVTYMLAU-RFVHGSKJSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl (3R)-3-(2-methylpropyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | BHOIFVAVTYMLAU-RFVHGSKJSA-N |
| SMILES | CC(C)C[C@@H]1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)