CAS 1381958-53-7 appears in our catalog under these names: (R)-tert-Butyl 2-tert-butylpiperazine-1-carboxylate hydrochloride, 95%, tert–Butyl (R)–2–(tert–butyl)piperazine–1–carboxylate hydrochloride, tert-Butyl (R)-2-(tert-butyl)piperazine-1-carboxylate hydrochloride, 95%, 95%, tert-Butyl (R)-2-(tert-butyl)piperazine-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
Tert-butyl (2R)-2-tert-butylpiperazine-1-carboxylate;hydrochloride (CAS 1381958-53-7) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl (2R)-2-tert-butylpiperazine-1-carboxylate;hydrochloride. InChIKey: ADQLANUYQADSBC-PPHPATTJSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl (2R)-2-tert-butylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | ADQLANUYQADSBC-PPHPATTJSA-N |
| SMILES | CC(C)(C)[C@@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)