cas: 1217469-14-1 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 3-isobutylpiperazine-1-carboxylate hydrochloride, 95%, 95% (CAS 1217469-14-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126QA-10g |
| cas | 1217469-14-1 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1470.80 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 904.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R)-3-(2-methylpropyl)piperazine-1-carboxylate;hydrochloride (CAS 1217469-14-1) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl (3R)-3-(2-methylpropyl)piperazine-1-carboxylate;hydrochloride. InChIKey: BHOIFVAVTYMLAU-RFVHGSKJSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl (3R)-3-(2-methylpropyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | BHOIFVAVTYMLAU-RFVHGSKJSA-N |
| SMILES | CC(C)C[C@@H]1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)