CAS 886779-61-9 appears in our catalog under these names: 3-tert-Butyl-piperazine-1-carboxylic acid tert-butyl ester, 95%, 3-tert-Butyl-piperazine-1-carboxylic acid tert-butyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
Tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride (CAS 886779-61-9) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride. InChIKey: CADRPFQADWMMKS-UHFFFAOYSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | CADRPFQADWMMKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)