CAS 1986330-78-2 is the registry number for tert-Butyl 3-(tert-butyl)piperazine-1-carboxylate hydrochloride, 98+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride (CAS 1986330-78-2) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride. InChIKey: CADRPFQADWMMKS-UHFFFAOYSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | CADRPFQADWMMKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)