Products 1986330-78-2

CAS 1986330-78-2 is the registry number for tert-Butyl 3-(tert-butyl)piperazine-1-carboxylate hydrochloride, 98+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride (CAS 1986330-78-2) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride. InChIKey: CADRPFQADWMMKS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H27ClN2O2
Molecular weight278.82 g/mol
IUPAC nametert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride
InChIKeyCADRPFQADWMMKS-UHFFFAOYSA-N
SMILESCC(C)(C)C1CN(CCN1)C(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)