cas: 31932-87-3 — see every product listed under this CAS number, including other names
(Rac)-3-Hydroxyphenylglycine 98% (CAS 31932-87-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A661138-250mg |
| cas | 31932-87-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3212.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A661138 |
2-amino-2-(3-hydroxyphenyl)acetic acid (CAS 31932-87-3) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-amino-2-(3-hydroxyphenyl)acetic acid. InChIKey: DQLYTFPAEVJTFM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-amino-2-(3-hydroxyphenyl)acetic acid |
| InChIKey | DQLYTFPAEVJTFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(C(=O)O)N |
Computed by PubChem (NCBI)