cas: 1391630-31-1 — see every product listed under this CAS number, including other names
(S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–2–cyclobutylacetic acid (CAS 1391630-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51690-100 |
| cas | 1391630-31-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 648.53 Pln | |
| GLPBio | 1g | 1509.74 Pln | |
| GLPBio | 250mg | 817.02 Pln | |
| GLPBio | 50mg | 550.23 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1391630-31-1) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: TXLUWFPQLXODBP-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | TXLUWFPQLXODBP-IBGZPJMESA-N |
| SMILES | C1CC(C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)