cas: 1391630-31-1 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclobutylacetic acid, 97%, 97% (CAS 1391630-31-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 10g, 25g, 100mg, 1g, 5g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HVE9-50mg |
| cas | 1391630-31-1 |
| size | 50mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 10g | 3165.20 Pln | |
| Chemat | 25g | 5714.00 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1922.00 Pln | |
| Chemat | 100g | 9059.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1391630-31-1) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: TXLUWFPQLXODBP-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | TXLUWFPQLXODBP-IBGZPJMESA-N |
| SMILES | C1CC(C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)