cas: 1391630-31-1 — see every product listed under this CAS number, including other names
Fmoc-Cyclobutyl-Gly-OH 97% (CAS 1391630-31-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154884-50mg |
| cas | 1391630-31-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 242.44 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 3424.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154884 |
(2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1391630-31-1) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: TXLUWFPQLXODBP-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | TXLUWFPQLXODBP-IBGZPJMESA-N |
| SMILES | C1CC(C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)