cas: 1198791-58-0 — see every product listed under this CAS number, including other names
(S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–2–methylpent–4–ynoic acid (CAS 1198791-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51696-100 |
| cas | 1198791-58-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 648.53 Pln | |
| GLPBio | 1g | 2019.91 Pln | |
| GLPBio | 250mg | 817.02 Pln | |
| GLPBio | 5g | 8446.24 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-ynoic acid (CAS 1198791-58-0) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-ynoic acid. InChIKey: ZXOKSWZUJXKQCQ-NRFANRHFSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-ynoic acid |
| InChIKey | ZXOKSWZUJXKQCQ-NRFANRHFSA-N |
| SMILES | C[C@](CC#C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)