CAS 96402-43-6 appears in our catalog under these names: Cbz-3-(1-naphthyl)-d-ala, 95%, Z-D-1-Nal-OH. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 5g, 250mg, 1g.
(2R)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 96402-43-6) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (2R)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: HNYQEAGTPQSPLT-LJQANCHMSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2R)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | HNYQEAGTPQSPLT-LJQANCHMSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC2=CC=CC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)