CAS 1326776-49-1 is the registry number for (S,E)-Methyl 2-methyl-4-(1,3-dioxoisoindolin-2-yl)-5-phenylpent-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (E,4S)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-5-phenylpent-2-enoate (CAS 1326776-49-1) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: methyl (E,4S)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-5-phenylpent-2-enoate. InChIKey: VXKYGAALTFYPOS-WCRPCQDQSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | methyl (E,4S)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-5-phenylpent-2-enoate |
| InChIKey | VXKYGAALTFYPOS-WCRPCQDQSA-N |
| SMILES | C/C(=C\[C@H](CC1=CC=CC=C1)N2C(=O)C3=CC=CC=C3C2=O)/C(=O)OC |
Computed by PubChem (NCBI)