CAS 65365-15-3 appears in our catalog under these names: Z-1-Nal-OH, 97%, (S)–2–(((Benzyloxy)carbonyl)amino)–3–(naphthalen–1–yl)propanoic acid, Cbz-1-Nal-OH 98%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(naphthalen-1-yl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 65365-15-3) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: HNYQEAGTPQSPLT-IBGZPJMESA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | HNYQEAGTPQSPLT-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=CC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)