cas: 959578-11-1 — see every product listed under this CAS number, including other names
(S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–5–phenylpentanoic acid (CAS 959578-11-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51761-10g |
| cas | 959578-11-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 4917.14 Pln | |
| GLPBio | 1g | 901.27 Pln | |
| GLPBio | 250mg | 704.69 Pln | |
| GLPBio | 5g | 2736.03 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 959578-11-1) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: JDBKBGOHVBNXRB-DEOSSOPVSA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid |
| InChIKey | JDBKBGOHVBNXRB-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)CCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)