cas: 959578-11-1 — see every product listed under this CAS number, including other names
N-Fmoc-L-2-Aminophenylpentanoic acid, 98% (CAS 959578-11-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047906-100MG |
| cas | 959578-11-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1221.46 Pln | |
| Fluorochem | 10g | 2137.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 959578-11-1) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: JDBKBGOHVBNXRB-DEOSSOPVSA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid |
| InChIKey | JDBKBGOHVBNXRB-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)CCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)