cas: 131690-56-7 — see every product listed under this CAS number, including other names
(S)–3–Amino–3–(4–methoxyphenyl)propanoic acid (CAS 131690-56-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB52033-10g |
| cas | 131690-56-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 2310.10 Pln | |
| GLPBio | 1g | 667.25 Pln | |
| GLPBio | 25g | 3948.28 Pln | |
| GLPBio | 5g | 1369.32 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-3-amino-3-(4-methoxyphenyl)propanoic acid (CAS 131690-56-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (3S)-3-amino-3-(4-methoxyphenyl)propanoic acid. InChIKey: NYTANCDDCQVQHG-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | NYTANCDDCQVQHG-VIFPVBQESA-N |
| SMILES | COC1=CC=C(C=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)