cas: 131690-56-7 — see every product listed under this CAS number, including other names
(S)-beta-(p-Methoxyphenyl)alanine, 95% (CAS 131690-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040486-250MG |
| cas | 131690-56-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 529.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-amino-3-(4-methoxyphenyl)propanoic acid (CAS 131690-56-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (3S)-3-amino-3-(4-methoxyphenyl)propanoic acid. InChIKey: NYTANCDDCQVQHG-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | NYTANCDDCQVQHG-VIFPVBQESA-N |
| SMILES | COC1=CC=C(C=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)