cas: 13512-57-7 — see every product listed under this CAS number, including other names
(S)–Benzyl 4–amino–2–((tert–butoxycarbonyl)amino)–4–oxobutanoate (CAS 13512-57-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB52069-10g |
| cas | 13512-57-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 751.50 Pln | |
| GLPBio | 1g | 517.47 Pln | |
| GLPBio | 25g | 1252.31 Pln | |
| GLPBio | 5g | 611.08 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 13512-57-7) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: VNFPRPGXGYMAKL-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | VNFPRPGXGYMAKL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)