cas: 13512-57-7 — see every product listed under this CAS number, including other names
(S)-Benzyl 4-amino-2-((tert-butoxycarbonyl)amino)-4-oxobutanoate, 97% (CAS 13512-57-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242047-1G |
| cas | 13512-57-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 627.92 Pln | |
| Fluorochem | 25g | 1471.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 13512-57-7) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: VNFPRPGXGYMAKL-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | VNFPRPGXGYMAKL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)