CAS 20445-33-4 appears in our catalog under these names: (S)-(+)-Alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, 95%, (S)–(+)–α–Methoxy–α–trifluoromethylphenylacetyl chloride, (S)-(+)-^a-Methoxy-^a-(trifluoromethyl)phenylacetyl chloride, S-(+)-α-Methoxy-α-(trifluoromethyl)phenylacetic acid chloride, (S)-(+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetyl Chloride [for Determination of the optical purity of Alcohols and Amines], >98.0%(GC)(T). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5g, 1g, 250mg, 50mg, 2g, 100mg, 500MG.
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride (CAS 20445-33-4) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride. InChIKey: PAORVUMOXXAMPL-SECBINFHSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| InChIKey | PAORVUMOXXAMPL-SECBINFHSA-N |
| SMILES | CO[C@](C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)