cas: 144054-70-6 — see every product listed under this CAS number, including other names
(S)-(-)-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol, >98.0%(HPLC) (CAS 144054-70-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2503-1G |
| cas | 144054-70-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 408.46 Pln | |
| TCI | 5g | 1544.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
(2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol (CAS 144054-70-6) is a chemical compound with the molecular formula C18H23NO and a molecular weight of 269.4 g/mol. IUPAC name: (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol. InChIKey: HZIHDWNOPKIOCK-INIZCTEOSA-N.
| Molecular formula | C18H23NO |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol |
| InChIKey | HZIHDWNOPKIOCK-INIZCTEOSA-N |
| SMILES | CC(C)(C)[C@@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)