cas: 144054-70-6 — see every product listed under this CAS number, including other names
(S)-(-)-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol, ≥98%, ≥98% (CAS 144054-70-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CEV-50mg |
| cas | 144054-70-6 |
| size | 50mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 102.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 798.80 Pln | |
| Chemat | 25g | 2901.20 Pln | |
| Chemat | 100g | 8478.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol (CAS 144054-70-6) is a chemical compound with the molecular formula C18H23NO and a molecular weight of 269.4 g/mol. IUPAC name: (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol. InChIKey: HZIHDWNOPKIOCK-INIZCTEOSA-N.
| Molecular formula | C18H23NO |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol |
| InChIKey | HZIHDWNOPKIOCK-INIZCTEOSA-N |
| SMILES | CC(C)(C)[C@@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)