cas: 1187931-26-5 — see every product listed under this CAS number, including other names
(S)-1-(2-Bromophenyl)ethanamine hydrochloride 97% (CAS 1187931-26-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106739-250mg |
| cas | 1187931-26-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1338.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A106739 |
(1S)-1-(2-bromophenyl)ethanamine;hydrochloride (CAS 1187931-26-5) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(2-bromophenyl)ethanamine;hydrochloride. InChIKey: MPTGUFFHOKLEFK-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(2-bromophenyl)ethanamine;hydrochloride |
| InChIKey | MPTGUFFHOKLEFK-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1Br)N.Cl |
Computed by PubChem (NCBI)