CAS 1187931-26-5 appears in our catalog under these names: (1S)-1-(2-Bromophenyl)ethan-1-amine hydrochloride, 95%, (S)–1–(2–Bromophenyl)ethanamine hydrochloride, (1S)-1-(2-bromophenyl)ethan-1-amine hydrochloride, (S)-1-(2-Bromophenyl)ethanamine hydrochloride 97%, (S)-1-(2-Bromophenyl)ethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 2,5g, 100mg.
(1S)-1-(2-bromophenyl)ethanamine;hydrochloride (CAS 1187931-26-5) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(2-bromophenyl)ethanamine;hydrochloride. InChIKey: MPTGUFFHOKLEFK-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(2-bromophenyl)ethanamine;hydrochloride |
| InChIKey | MPTGUFFHOKLEFK-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1Br)N.Cl |
Computed by PubChem (NCBI)