cas: 161121-02-4 — see every product listed under this CAS number, including other names
(S)-1-(3,4-Dimethoxyphenyl)-propan-2-ol (CAS 161121-02-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049646-250MG |
| cas | 161121-02-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2814.65 Pln | |
| Fluorochem | 1g | 4938.90 Pln | |
| Fluorochem | 5g | 19522.31 Pln |
| delivery time | 3-4 weeks |
|---|
(2S)-1-(3,4-dimethoxyphenyl)propan-2-ol (CAS 161121-02-4) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: (2S)-1-(3,4-dimethoxyphenyl)propan-2-ol. InChIKey: KWJDGWGMDAQESJ-QMMMGPOBSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | (2S)-1-(3,4-dimethoxyphenyl)propan-2-ol |
| InChIKey | KWJDGWGMDAQESJ-QMMMGPOBSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C=C1)OC)OC)O |
Computed by PubChem (NCBI)