cas: 161121-02-4 — see every product listed under this CAS number, including other names
(S)-1-(3,4-dimethoxyphenyl)-2-propanol, 99%, 99% (CAS 161121-02-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112S7T-250mg |
| cas | 161121-02-4 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 2046.80 Pln | |
| Chemat | 1g | 3582.80 Pln | |
| Chemat | 5g | 14147.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-(3,4-dimethoxyphenyl)propan-2-ol (CAS 161121-02-4) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: (2S)-1-(3,4-dimethoxyphenyl)propan-2-ol. InChIKey: KWJDGWGMDAQESJ-QMMMGPOBSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | (2S)-1-(3,4-dimethoxyphenyl)propan-2-ol |
| InChIKey | KWJDGWGMDAQESJ-QMMMGPOBSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C=C1)OC)OC)O |
Computed by PubChem (NCBI)