(S)-1-(3-(Trifluoromethoxy)phenyl)ethan-1-amine, 95%
cas: 1228542-85-5 — see every product listed under this CAS number, including other names
(S)-1-(3-(Trifluoromethoxy)phenyl)ethan-1-amine, 95% (CAS 1228542-85-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A809820-250mg |
| cas | 1228542-85-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1210.31 Pln | |
| Ambeed | 1g | 3018.12 Pln | |
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 1086.80 Pln | |
| Chemat | 1g | 2704.40 Pln | |
| BLDpharm | 100mg | 753.09 Pln | |
| BLDpharm | 250mg | 1302.90 Pln | |
| BLDpharm | 1g | 3246.66 Pln | |
| Fluorochem | 100mg | 607.10 Pln | |
| Fluorochem | 250mg | 950.72 Pln | |
| Fluorochem | 1g | 2497.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine (CAS 1228542-85-5) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: (1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine. InChIKey: XRRKIDIISISOKH-LURJTMIESA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | (1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine |
| InChIKey | XRRKIDIISISOKH-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)