CAS 1213834-55-9 is the registry number for (S)-2,2,2-Trifluoro-1-(2-methoxyphenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1S)-2,2,2-trifluoro-1-(2-methoxyphenyl)ethanamine (CAS 1213834-55-9) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(2-methoxyphenyl)ethanamine. InChIKey: LMXVBSFRTBFWFN-QMMMGPOBSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(2-methoxyphenyl)ethanamine |
| InChIKey | LMXVBSFRTBFWFN-QMMMGPOBSA-N |
| SMILES | COC1=CC=CC=C1[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)