CAS 220996-42-9 is the registry number for 4-Amino-2-(2,2,2-trifluoroethoxy)toluene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-methyl-3-(2,2,2-trifluoroethoxy)aniline (CAS 220996-42-9) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 4-methyl-3-(2,2,2-trifluoroethoxy)aniline. InChIKey: PUUWPAZAVMKTHC-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 4-methyl-3-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | PUUWPAZAVMKTHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)